C25H42N4O2 — CID 42757238
N-[2-(diethylamino)ethyl]-5-(hexanoylamino)-2-(4-methylpiperidin-1-yl)benzamide (PubChem CID 42757238) has the molecular formula C25H42N4O2 and a molecular weight of 430.64 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-5-(hexanoylamino)-2-(4-methylpiperidin-1-yl)benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-5-(hexanoylamino)-2-(4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 42757238 |
| Molecular Formula | C25H42N4O2 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-5-(hexanoylamino)-2-(4-methylpiperidin-1-yl)benzamide |
| SMILES | CCCCCC(=O)Nc1ccc(N2CCC(C)CC2)c(C(=O)NCCN(CC)CC)c1 |
| InChI | InChI=1S/C25H42N4O2/c1-5-8-9-10-24(30)27-21-11-12-23(29-16-13-20(4)14-17-29)22(19-21)25(31)26-15-18-28(6-2)7-3/h11-12,19-20H,5-10,13-18H2,1-4H3,(H,26,31)(H,27,30) |
| InChIKey | PCWPKDFDTSJJOW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|