C31H46N4O2 — CID 3907627
N-[2-(diethylamino)ethyl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(nonanoylamino)benzamide (PubChem CID 3907627) has the molecular formula C31H46N4O2 and a molecular weight of 506.74 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(nonanoylamino)benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(nonanoylamino)benzamide |
|---|---|
| PubChem CID | 3907627 |
| Molecular Formula | C31H46N4O2 |
| Molecular Weight | 506.74 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-(nonanoylamino)benzamide |
| SMILES | CCCCCCCCC(=O)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NCCN(CC)CC)c1 |
| InChI | InChI=1S/C31H46N4O2/c1-4-7-8-9-10-11-16-30(36)33-27-17-18-29(35-21-19-25-14-12-13-15-26(25)24-35)28(23-27)31(37)32-20-22-34(5-2)6-3/h12-15,17-18,23H,4-11,16,19-22,24H2,1-3H3,(H,32,37)(H,33,36) |
| InChIKey | OKQGEUZLRGTRDI-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.74 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|