C31H36N4O2 — CID 6293224
N-[2-(diethylamino)ethyl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[[(E)-3-phenylprop-2-enoyl]amino]benzamide (PubChem CID 6293224) has the molecular formula C31H36N4O2 and a molecular weight of 496.66 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[[(E)-3-phenylprop-2-enoyl]amino]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[[(E)-3-phenylprop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 6293224 |
| Molecular Formula | C31H36N4O2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[[(E)-3-phenylprop-2-enoyl]amino]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(NC(=O)/C=C/c2ccccc2)ccc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C31H36N4O2/c1-3-34(4-2)21-19-32-31(37)28-22-27(33-30(36)17-14-24-10-6-5-7-11-24)15-16-29(28)35-20-18-25-12-8-9-13-26(25)23-35/h5-17,22H,3-4,18-21,23H2,1-2H3,(H,32,37)(H,33,36)/b17-14+ |
| InChIKey | PTFMYPJSRQCSGC-SAPNQHFASA-N |
| XLogP | 4.97 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|