C20H33N5O2 — CID 42756110
N-[2-(diethylamino)ethyl]-5-(dimethylcarbamoylamino)-2-pyrrolidin-1-ylbenzamide (PubChem CID 42756110) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-5-(dimethylcarbamoylamino)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-5-(dimethylcarbamoylamino)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 42756110 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-5-(dimethylcarbamoylamino)-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(NC(=O)N(C)C)ccc1N1CCCC1 |
| InChI | InChI=1S/C20H33N5O2/c1-5-24(6-2)14-11-21-19(26)17-15-16(22-20(27)23(3)4)9-10-18(17)25-12-7-8-13-25/h9-10,15H,5-8,11-14H2,1-4H3,(H,21,26)(H,22,27) |
| InChIKey | FWHLGARWEMRFPN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|