C18H28N4O2 — CID 42755610
5-(dimethylcarbamoylamino)-2-piperidin-1-yl-N-propylbenzamide (PubChem CID 42755610) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 5-(dimethylcarbamoylamino)-2-piperidin-1-yl-N-propylbenzamide.
| Compound Name | 5-(dimethylcarbamoylamino)-2-piperidin-1-yl-N-propylbenzamide |
|---|---|
| PubChem CID | 42755610 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 5-(dimethylcarbamoylamino)-2-piperidin-1-yl-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cc(NC(=O)N(C)C)ccc1N1CCCCC1 |
| InChI | InChI=1S/C18H28N4O2/c1-4-10-19-17(23)15-13-14(20-18(24)21(2)3)8-9-16(15)22-11-6-5-7-12-22/h8-9,13H,4-7,10-12H2,1-3H3,(H,19,23)(H,20,24) |
| InChIKey | HACINJBWWYHOFK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|