C22H26Cl2N4O2 — CID 4002213
5-[(2,3-dichlorophenyl)carbamoylamino]-2-piperidin-1-yl-N-propylbenzamide (PubChem CID 4002213) has the molecular formula C22H26Cl2N4O2 and a molecular weight of 449.38 g/mol. Its IUPAC name is 5-[(2,3-dichlorophenyl)carbamoylamino]-2-piperidin-1-yl-N-propylbenzamide.
| Compound Name | 5-[(2,3-dichlorophenyl)carbamoylamino]-2-piperidin-1-yl-N-propylbenzamide |
|---|---|
| PubChem CID | 4002213 |
| Molecular Formula | C22H26Cl2N4O2 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 5-[(2,3-dichlorophenyl)carbamoylamino]-2-piperidin-1-yl-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cc(NC(=O)Nc2cccc(Cl)c2Cl)ccc1N1CCCCC1 |
| InChI | InChI=1S/C22H26Cl2N4O2/c1-2-11-25-21(29)16-14-15(9-10-19(16)28-12-4-3-5-13-28)26-22(30)27-18-8-6-7-17(23)20(18)24/h6-10,14H,2-5,11-13H2,1H3,(H,25,29)(H2,26,27,30) |
| InChIKey | QFUVPEZMKPSTTB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|