C19H22Cl2N4O2 — CID 4563439
5-[(2,3-dichlorophenyl)carbamoylamino]-2-(dimethylamino)-N-propylbenzamide (PubChem CID 4563439) has the molecular formula C19H22Cl2N4O2 and a molecular weight of 409.32 g/mol. Its IUPAC name is 5-[(2,3-dichlorophenyl)carbamoylamino]-2-(dimethylamino)-N-propylbenzamide.
| Compound Name | 5-[(2,3-dichlorophenyl)carbamoylamino]-2-(dimethylamino)-N-propylbenzamide |
|---|---|
| PubChem CID | 4563439 |
| Molecular Formula | C19H22Cl2N4O2 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 5-[(2,3-dichlorophenyl)carbamoylamino]-2-(dimethylamino)-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cc(NC(=O)Nc2cccc(Cl)c2Cl)ccc1N(C)C |
| InChI | InChI=1S/C19H22Cl2N4O2/c1-4-10-22-18(26)13-11-12(8-9-16(13)25(2)3)23-19(27)24-15-7-5-6-14(20)17(15)21/h5-9,11H,4,10H2,1-3H3,(H,22,26)(H2,23,24,27) |
| InChIKey | RFFQYGWHYCCWBK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|