C20H23N5O2 — CID 3950818
5-[(3-cyanophenyl)carbamoylamino]-2-(dimethylamino)-N-propylbenzamide (PubChem CID 3950818) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 5-[(3-cyanophenyl)carbamoylamino]-2-(dimethylamino)-N-propylbenzamide.
| Compound Name | 5-[(3-cyanophenyl)carbamoylamino]-2-(dimethylamino)-N-propylbenzamide |
|---|---|
| PubChem CID | 3950818 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 5-[(3-cyanophenyl)carbamoylamino]-2-(dimethylamino)-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cc(NC(=O)Nc2cccc(C#N)c2)ccc1N(C)C |
| InChI | InChI=1S/C20H23N5O2/c1-4-10-22-19(26)17-12-16(8-9-18(17)25(2)3)24-20(27)23-15-7-5-6-14(11-15)13-21/h5-9,11-12H,4,10H2,1-3H3,(H,22,26)(H2,23,24,27) |
| InChIKey | KLWMUQQJZIQBMZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|