C17H16N4O2 — CID 109077804
2-N-(3-cyanophenyl)-4-N-propylpyridine-2,4-dicarboxamide (PubChem CID 109077804) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-N-(3-cyanophenyl)-4-N-propylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(3-cyanophenyl)-4-N-propylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109077804 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-N-(3-cyanophenyl)-4-N-propylpyridine-2,4-dicarboxamide |
| SMILES | CCCNC(=O)c1ccnc(C(=O)Nc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C17H16N4O2/c1-2-7-20-16(22)13-6-8-19-15(10-13)17(23)21-14-5-3-4-12(9-14)11-18/h3-6,8-10H,2,7H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | XJYNMNAFXGOMRO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |