C20H13ClN4O2 — CID 109092850
2-N-(3-chlorophenyl)-4-N-(3-cyanophenyl)pyridine-2,4-dicarboxamide (PubChem CID 109092850) has the molecular formula C20H13ClN4O2 and a molecular weight of 376.80 g/mol. Its IUPAC name is 2-N-(3-chlorophenyl)-4-N-(3-cyanophenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(3-chlorophenyl)-4-N-(3-cyanophenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109092850 |
| Molecular Formula | C20H13ClN4O2 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2-N-(3-chlorophenyl)-4-N-(3-cyanophenyl)pyridine-2,4-dicarboxamide |
| SMILES | N#Cc1cccc(NC(=O)c2ccnc(C(=O)Nc3cccc(Cl)c3)c2)c1 |
| InChI | InChI=1S/C20H13ClN4O2/c21-15-4-2-6-17(11-15)25-20(27)18-10-14(7-8-23-18)19(26)24-16-5-1-3-13(9-16)12-22/h1-11H,(H,24,26)(H,25,27) |
| InChIKey | IBVBKJXGCAMHNM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |