C22H19N5O2 — CID 109093258
4-N-(3-cyanophenyl)-2-N-[4-(dimethylamino)phenyl]pyridine-2,4-dicarboxamide (PubChem CID 109093258) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 4-N-(3-cyanophenyl)-2-N-[4-(dimethylamino)phenyl]pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(3-cyanophenyl)-2-N-[4-(dimethylamino)phenyl]pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109093258 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 4-N-(3-cyanophenyl)-2-N-[4-(dimethylamino)phenyl]pyridine-2,4-dicarboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cc(C(=O)Nc3cccc(C#N)c3)ccn2)cc1 |
| InChI | InChI=1S/C22H19N5O2/c1-27(2)19-8-6-17(7-9-19)25-22(29)20-13-16(10-11-24-20)21(28)26-18-5-3-4-15(12-18)14-23/h3-13H,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | KKUDMFMMUUSGFC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|