C17H14N4O2 — CID 109079174
4-N-(3-cyanophenyl)-2-N-prop-2-enylpyridine-2,4-dicarboxamide (PubChem CID 109079174) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 4-N-(3-cyanophenyl)-2-N-prop-2-enylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(3-cyanophenyl)-2-N-prop-2-enylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109079174 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 4-N-(3-cyanophenyl)-2-N-prop-2-enylpyridine-2,4-dicarboxamide |
| SMILES | C=CCNC(=O)c1cc(C(=O)Nc2cccc(C#N)c2)ccn1 |
| InChI | InChI=1S/C17H14N4O2/c1-2-7-20-17(23)15-10-13(6-8-19-15)16(22)21-14-5-3-4-12(9-14)11-18/h2-6,8-10H,1,7H2,(H,20,23)(H,21,22) |
| InChIKey | FDJGBUIKCQSNBI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|