C21H15ClN4O2 — CID 109086783
2-N-[(4-chlorophenyl)methyl]-4-N-(3-cyanophenyl)pyridine-2,4-dicarboxamide (PubChem CID 109086783) has the molecular formula C21H15ClN4O2 and a molecular weight of 390.83 g/mol. Its IUPAC name is 2-N-[(4-chlorophenyl)methyl]-4-N-(3-cyanophenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-[(4-chlorophenyl)methyl]-4-N-(3-cyanophenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109086783 |
| Molecular Formula | C21H15ClN4O2 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 2-N-[(4-chlorophenyl)methyl]-4-N-(3-cyanophenyl)pyridine-2,4-dicarboxamide |
| SMILES | N#Cc1cccc(NC(=O)c2ccnc(C(=O)NCc3ccc(Cl)cc3)c2)c1 |
| InChI | InChI=1S/C21H15ClN4O2/c22-17-6-4-14(5-7-17)13-25-21(28)19-11-16(8-9-24-19)20(27)26-18-3-1-2-15(10-18)12-23/h1-11H,13H2,(H,25,28)(H,26,27) |
| InChIKey | SDYDPNPGHJZOTP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |