C23H33N5O3 — CID 3883285
N-[2-(diethylamino)ethyl]-2-(dimethylamino)-5-[(2-methoxyphenyl)carbamoylamino]benzamide (PubChem CID 3883285) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-(dimethylamino)-5-[(2-methoxyphenyl)carbamoylamino]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-(dimethylamino)-5-[(2-methoxyphenyl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 3883285 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-(dimethylamino)-5-[(2-methoxyphenyl)carbamoylamino]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(NC(=O)Nc2ccccc2OC)ccc1N(C)C |
| InChI | InChI=1S/C23H33N5O3/c1-6-28(7-2)15-14-24-22(29)18-16-17(12-13-20(18)27(3)4)25-23(30)26-19-10-8-9-11-21(19)31-5/h8-13,16H,6-7,14-15H2,1-5H3,(H,24,29)(H2,25,26,30) |
| InChIKey | DHQLTHOBHQQXEY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|