C15H23IN4O3 — CID 142817541
N-[2-(diethylamino)ethyl]-4-(iodocarbamoylamino)-2-methoxybenzamide (PubChem CID 142817541) has the molecular formula C15H23IN4O3 and a molecular weight of 434.28 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-(iodocarbamoylamino)-2-methoxybenzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-(iodocarbamoylamino)-2-methoxybenzamide |
|---|---|
| PubChem CID | 142817541 |
| Molecular Formula | C15H23IN4O3 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-(iodocarbamoylamino)-2-methoxybenzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=O)NI)cc1OC |
| InChI | InChI=1S/C15H23IN4O3/c1-4-20(5-2)9-8-17-14(21)12-7-6-11(10-13(12)23-3)18-15(22)19-16/h6-7,10H,4-5,8-9H2,1-3H3,(H,17,21)(H2,18,19,22) |
| InChIKey | SYTBBUGETUHWHL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|