C23H31N3O5 — CID 66934739
N-[2-(diethylamino)ethyl]-4-[(2,5-dimethoxybenzoyl)amino]-2-methoxybenzamide (PubChem CID 66934739) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-[(2,5-dimethoxybenzoyl)amino]-2-methoxybenzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-[(2,5-dimethoxybenzoyl)amino]-2-methoxybenzamide |
|---|---|
| PubChem CID | 66934739 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-[(2,5-dimethoxybenzoyl)amino]-2-methoxybenzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=O)c2cc(OC)ccc2OC)cc1OC |
| InChI | InChI=1S/C23H31N3O5/c1-6-26(7-2)13-12-24-22(27)18-10-8-16(14-21(18)31-5)25-23(28)19-15-17(29-3)9-11-20(19)30-4/h8-11,14-15H,6-7,12-13H2,1-5H3,(H,24,27)(H,25,28) |
| InChIKey | IJPWSHAKUJPJBC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |