C21H27N3O4 — CID 5145883
5-[(2,4-dimethoxybenzoyl)amino]-2-(dimethylamino)-N-propylbenzamide (PubChem CID 5145883) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 5-[(2,4-dimethoxybenzoyl)amino]-2-(dimethylamino)-N-propylbenzamide.
| Compound Name | 5-[(2,4-dimethoxybenzoyl)amino]-2-(dimethylamino)-N-propylbenzamide |
|---|---|
| PubChem CID | 5145883 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 5-[(2,4-dimethoxybenzoyl)amino]-2-(dimethylamino)-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cc(NC(=O)c2ccc(OC)cc2OC)ccc1N(C)C |
| InChI | InChI=1S/C21H27N3O4/c1-6-11-22-20(25)17-12-14(7-10-18(17)24(2)3)23-21(26)16-9-8-15(27-4)13-19(16)28-5/h7-10,12-13H,6,11H2,1-5H3,(H,22,25)(H,23,26) |
| InChIKey | OVQCVUFRAGQFOF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|