C20H24ClN3O3 — CID 3297823
5-[[2-(4-chlorophenoxy)acetyl]amino]-2-(dimethylamino)-N-propylbenzamide (PubChem CID 3297823) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is 5-[[2-(4-chlorophenoxy)acetyl]amino]-2-(dimethylamino)-N-propylbenzamide.
| Compound Name | 5-[[2-(4-chlorophenoxy)acetyl]amino]-2-(dimethylamino)-N-propylbenzamide |
|---|---|
| PubChem CID | 3297823 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 5-[[2-(4-chlorophenoxy)acetyl]amino]-2-(dimethylamino)-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cc(NC(=O)COc2ccc(Cl)cc2)ccc1N(C)C |
| InChI | InChI=1S/C20H24ClN3O3/c1-4-11-22-20(26)17-12-15(7-10-18(17)24(2)3)23-19(25)13-27-16-8-5-14(21)6-9-16/h5-10,12H,4,11,13H2,1-3H3,(H,22,26)(H,23,25) |
| InChIKey | AKZMPAGEKADVOQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|