C24H30ClN3O4 — CID 3931057
5-[[2-(4-chlorophenoxy)acetyl]amino]-N-(2-methoxyethyl)-2-(4-methylpiperidin-1-yl)benzamide (PubChem CID 3931057) has the molecular formula C24H30ClN3O4 and a molecular weight of 459.97 g/mol. Its IUPAC name is 5-[[2-(4-chlorophenoxy)acetyl]amino]-N-(2-methoxyethyl)-2-(4-methylpiperidin-1-yl)benzamide.
| Compound Name | 5-[[2-(4-chlorophenoxy)acetyl]amino]-N-(2-methoxyethyl)-2-(4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 3931057 |
| Molecular Formula | C24H30ClN3O4 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 5-[[2-(4-chlorophenoxy)acetyl]amino]-N-(2-methoxyethyl)-2-(4-methylpiperidin-1-yl)benzamide |
| SMILES | COCCNC(=O)c1cc(NC(=O)COc2ccc(Cl)cc2)ccc1N1CCC(C)CC1 |
| InChI | InChI=1S/C24H30ClN3O4/c1-17-9-12-28(13-10-17)22-8-5-19(15-21(22)24(30)26-11-14-31-2)27-23(29)16-32-20-6-3-18(25)4-7-20/h3-8,15,17H,9-14,16H2,1-2H3,(H,26,30)(H,27,29) |
| InChIKey | ROUQQRXOERJCOK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|