C24H32N4O4 — CID 3557772
N-(2-methoxyethyl)-5-[(3-methoxyphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)benzamide (PubChem CID 3557772) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-[(3-methoxyphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)benzamide.
| Compound Name | N-(2-methoxyethyl)-5-[(3-methoxyphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 3557772 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | N-(2-methoxyethyl)-5-[(3-methoxyphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)benzamide |
| SMILES | COCCNC(=O)c1cc(NC(=O)Nc2cccc(OC)c2)ccc1N1CCC(C)CC1 |
| InChI | InChI=1S/C24H32N4O4/c1-17-9-12-28(13-10-17)22-8-7-19(16-21(22)23(29)25-11-14-31-2)27-24(30)26-18-5-4-6-20(15-18)32-3/h4-8,15-17H,9-14H2,1-3H3,(H,25,29)(H2,26,27,30) |
| InChIKey | GCOWZZWTFVFQOX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|