C24H32N4O5 — CID 4672722
5-[(3,5-dimethoxyphenyl)carbamoylamino]-N-(2-methoxyethyl)-2-piperidin-1-ylbenzamide (PubChem CID 4672722) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is 5-[(3,5-dimethoxyphenyl)carbamoylamino]-N-(2-methoxyethyl)-2-piperidin-1-ylbenzamide.
| Compound Name | 5-[(3,5-dimethoxyphenyl)carbamoylamino]-N-(2-methoxyethyl)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 4672722 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 5-[(3,5-dimethoxyphenyl)carbamoylamino]-N-(2-methoxyethyl)-2-piperidin-1-ylbenzamide |
| SMILES | COCCNC(=O)c1cc(NC(=O)Nc2cc(OC)cc(OC)c2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C24H32N4O5/c1-31-12-9-25-23(29)21-15-17(7-8-22(21)28-10-5-4-6-11-28)26-24(30)27-18-13-19(32-2)16-20(14-18)33-3/h7-8,13-16H,4-6,9-12H2,1-3H3,(H,25,29)(H2,26,27,30) |
| InChIKey | LHTUHSRWNDPOTJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|