C25H28F6N4O3 — CID 42661850
5-[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]-N-(3-methoxypropyl)-2-piperidin-1-ylbenzamide (PubChem CID 42661850) has the molecular formula C25H28F6N4O3 and a molecular weight of 546.51 g/mol. Its IUPAC name is 5-[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]-N-(3-methoxypropyl)-2-piperidin-1-ylbenzamide.
| Compound Name | 5-[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]-N-(3-methoxypropyl)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 42661850 |
| Molecular Formula | C25H28F6N4O3 |
| Molecular Weight | 546.51 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 5-[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]-N-(3-methoxypropyl)-2-piperidin-1-ylbenzamide |
| SMILES | COCCCNC(=O)c1cc(NC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C25H28F6N4O3/c1-38-11-5-8-32-22(36)20-15-18(6-7-21(20)35-9-3-2-4-10-35)33-23(37)34-19-13-16(24(26,27)28)12-17(14-19)25(29,30)31/h6-7,12-15H,2-5,8-11H2,1H3,(H,32,36)(H2,33,34,37) |
| InChIKey | ZSGQOYHKPFSJNF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|