C23H28ClFN4O3 — CID 3260050
5-[(3-chloro-4-fluorophenyl)carbamoylamino]-N-(3-methoxypropyl)-2-piperidin-1-ylbenzamide (PubChem CID 3260050) has the molecular formula C23H28ClFN4O3 and a molecular weight of 462.95 g/mol. Its IUPAC name is 5-[(3-chloro-4-fluorophenyl)carbamoylamino]-N-(3-methoxypropyl)-2-piperidin-1-ylbenzamide.
| Compound Name | 5-[(3-chloro-4-fluorophenyl)carbamoylamino]-N-(3-methoxypropyl)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 3260050 |
| Molecular Formula | C23H28ClFN4O3 |
| Molecular Weight | 462.95 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 5-[(3-chloro-4-fluorophenyl)carbamoylamino]-N-(3-methoxypropyl)-2-piperidin-1-ylbenzamide |
| SMILES | COCCCNC(=O)c1cc(NC(=O)Nc2ccc(F)c(Cl)c2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C23H28ClFN4O3/c1-32-13-5-10-26-22(30)18-14-16(7-9-21(18)29-11-3-2-4-12-29)27-23(31)28-17-6-8-20(25)19(24)15-17/h6-9,14-15H,2-5,10-13H2,1H3,(H,26,30)(H2,27,28,31) |
| InChIKey | SNSYFZDKKFEZGY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.95 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|