C24H30Cl2N4O3 — CID 3544747
5-[(3,4-dichlorophenyl)carbamoylamino]-N-(3-methoxypropyl)-2-(4-methylpiperidin-1-yl)benzamide (PubChem CID 3544747) has the molecular formula C24H30Cl2N4O3 and a molecular weight of 493.44 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)carbamoylamino]-N-(3-methoxypropyl)-2-(4-methylpiperidin-1-yl)benzamide.
| Compound Name | 5-[(3,4-dichlorophenyl)carbamoylamino]-N-(3-methoxypropyl)-2-(4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 3544747 |
| Molecular Formula | C24H30Cl2N4O3 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)carbamoylamino]-N-(3-methoxypropyl)-2-(4-methylpiperidin-1-yl)benzamide |
| SMILES | COCCCNC(=O)c1cc(NC(=O)Nc2ccc(Cl)c(Cl)c2)ccc1N1CCC(C)CC1 |
| InChI | InChI=1S/C24H30Cl2N4O3/c1-16-8-11-30(12-9-16)22-7-5-17(14-19(22)23(31)27-10-3-13-33-2)28-24(32)29-18-4-6-20(25)21(26)15-18/h4-7,14-16H,3,8-13H2,1-2H3,(H,27,31)(H2,28,29,32) |
| InChIKey | KJMSMRYGMMXMNH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|