C25H34N4O4 — CID 4643884
5-[(2-ethoxyphenyl)carbamoylamino]-N-(3-methoxypropyl)-2-piperidin-1-ylbenzamide (PubChem CID 4643884) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is 5-[(2-ethoxyphenyl)carbamoylamino]-N-(3-methoxypropyl)-2-piperidin-1-ylbenzamide.
| Compound Name | 5-[(2-ethoxyphenyl)carbamoylamino]-N-(3-methoxypropyl)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 4643884 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 5-[(2-ethoxyphenyl)carbamoylamino]-N-(3-methoxypropyl)-2-piperidin-1-ylbenzamide |
| SMILES | CCOc1ccccc1NC(=O)Nc1ccc(N2CCCCC2)c(C(=O)NCCCOC)c1 |
| InChI | InChI=1S/C25H34N4O4/c1-3-33-23-11-6-5-10-21(23)28-25(31)27-19-12-13-22(29-15-7-4-8-16-29)20(18-19)24(30)26-14-9-17-32-2/h5-6,10-13,18H,3-4,7-9,14-17H2,1-2H3,(H,26,30)(H2,27,28,31) |
| InChIKey | LKIDAPHPNMHOKE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|