C32H40ClN5O4 — CID 4993891
5-[[2-(4-chlorophenoxy)acetyl]amino]-N-[2-(diethylamino)ethyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 4993891) has the molecular formula C32H40ClN5O4 and a molecular weight of 594.16 g/mol. Its IUPAC name is 5-[[2-(4-chlorophenoxy)acetyl]amino]-N-[2-(diethylamino)ethyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-[[2-(4-chlorophenoxy)acetyl]amino]-N-[2-(diethylamino)ethyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 4993891 |
| Molecular Formula | C32H40ClN5O4 |
| Molecular Weight | 594.16 g/mol |
| Exact Mass | 593.28 |
| IUPAC Name | 5-[[2-(4-chlorophenoxy)acetyl]amino]-N-[2-(diethylamino)ethyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(NC(=O)COc2ccc(Cl)cc2)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C32H40ClN5O4/c1-4-36(5-2)17-16-34-32(40)27-22-25(35-31(39)23-42-26-13-10-24(33)11-14-26)12-15-28(27)37-18-20-38(21-19-37)29-8-6-7-9-30(29)41-3/h6-15,22H,4-5,16-21,23H2,1-3H3,(H,34,40)(H,35,39) |
| InChIKey | FQIWOGCZVFZOSO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.16 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|