C28H31ClN4O4 — CID 5138511
5-[(2-chlorobenzoyl)amino]-N-(2-methoxyethyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide (PubChem CID 5138511) has the molecular formula C28H31ClN4O4 and a molecular weight of 523.03 g/mol. Its IUPAC name is 5-[(2-chlorobenzoyl)amino]-N-(2-methoxyethyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide.
| Compound Name | 5-[(2-chlorobenzoyl)amino]-N-(2-methoxyethyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 5138511 |
| Molecular Formula | C28H31ClN4O4 |
| Molecular Weight | 523.03 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 5-[(2-chlorobenzoyl)amino]-N-(2-methoxyethyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]benzamide |
| SMILES | COCCNC(=O)c1cc(NC(=O)c2ccccc2Cl)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C28H31ClN4O4/c1-36-18-13-30-27(34)22-19-20(31-28(35)21-7-3-4-8-23(21)29)11-12-24(22)32-14-16-33(17-15-32)25-9-5-6-10-26(25)37-2/h3-12,19H,13-18H2,1-2H3,(H,30,34)(H,31,35) |
| InChIKey | WKOCWGLEBIEPTN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.03 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|