C29H33ClN4O3 — CID 42752940
2-(4-benzylpiperazin-1-yl)-5-[(2-chlorobenzoyl)amino]-N-(3-methoxypropyl)benzamide (PubChem CID 42752940) has the molecular formula C29H33ClN4O3 and a molecular weight of 521.06 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-5-[(2-chlorobenzoyl)amino]-N-(3-methoxypropyl)benzamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-5-[(2-chlorobenzoyl)amino]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 42752940 |
| Molecular Formula | C29H33ClN4O3 |
| Molecular Weight | 521.06 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-5-[(2-chlorobenzoyl)amino]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1cc(NC(=O)c2ccccc2Cl)ccc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H33ClN4O3/c1-37-19-7-14-31-28(35)25-20-23(32-29(36)24-10-5-6-11-26(24)30)12-13-27(25)34-17-15-33(16-18-34)21-22-8-3-2-4-9-22/h2-6,8-13,20H,7,14-19,21H2,1H3,(H,31,35)(H,32,36) |
| InChIKey | RAAGPEHAPIVWFY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.06 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|