C31H39N5O4 — CID 3504556
2-(4-benzylpiperazin-1-yl)-5-[(4-ethoxyphenyl)carbamoylamino]-N-(3-methoxypropyl)benzamide (PubChem CID 3504556) has the molecular formula C31H39N5O4 and a molecular weight of 545.68 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-5-[(4-ethoxyphenyl)carbamoylamino]-N-(3-methoxypropyl)benzamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-5-[(4-ethoxyphenyl)carbamoylamino]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 3504556 |
| Molecular Formula | C31H39N5O4 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-5-[(4-ethoxyphenyl)carbamoylamino]-N-(3-methoxypropyl)benzamide |
| SMILES | CCOc1ccc(NC(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)c(C(=O)NCCCOC)c2)cc1 |
| InChI | InChI=1S/C31H39N5O4/c1-3-40-27-13-10-25(11-14-27)33-31(38)34-26-12-15-29(28(22-26)30(37)32-16-7-21-39-2)36-19-17-35(18-20-36)23-24-8-5-4-6-9-24/h4-6,8-15,22H,3,7,16-21,23H2,1-2H3,(H,32,37)(H2,33,34,38) |
| InChIKey | ALQWTWLUPWVQOY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|