C33H32Cl2N4O3 — CID 42755759
5-[(2,4-dichlorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide (PubChem CID 42755759) has the molecular formula C33H32Cl2N4O3 and a molecular weight of 603.55 g/mol. Its IUPAC name is 5-[(2,4-dichlorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide.
| Compound Name | 5-[(2,4-dichlorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 42755759 |
| Molecular Formula | C33H32Cl2N4O3 |
| Molecular Weight | 603.55 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | 5-[(2,4-dichlorobenzoyl)amino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(2-phenylethyl)benzamide |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)c3ccc(Cl)cc3Cl)cc2C(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C33H32Cl2N4O3/c1-42-31-10-6-5-9-30(31)39-19-17-38(18-20-39)29-14-12-25(37-33(41)26-13-11-24(34)21-28(26)35)22-27(29)32(40)36-16-15-23-7-3-2-4-8-23/h2-14,21-22H,15-20H2,1H3,(H,36,40)(H,37,41) |
| InChIKey | GAFZSVRYYOEUHY-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.55 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|