C24H32N2O6 — CID 4051354
N-[6-[(2,4-dimethoxybenzoyl)amino]hexyl]-2,4-dimethoxybenzamide (PubChem CID 4051354) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is N-[6-[(2,4-dimethoxybenzoyl)amino]hexyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[6-[(2,4-dimethoxybenzoyl)amino]hexyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 4051354 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | N-[6-[(2,4-dimethoxybenzoyl)amino]hexyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCCCCNC(=O)c2ccc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C24H32N2O6/c1-29-17-9-11-19(21(15-17)31-3)23(27)25-13-7-5-6-8-14-26-24(28)20-12-10-18(30-2)16-22(20)32-4/h9-12,15-16H,5-8,13-14H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | SVOMJNGNSNHMRZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|