C13H19NO5 — CID 60654650
N-[2-(2-hydroxyethoxy)ethyl]-2,4-dimethoxybenzamide (PubChem CID 60654650) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 60654650 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCOCCO)c(OC)c1 |
| InChI | InChI=1S/C13H19NO5/c1-17-10-3-4-11(12(9-10)18-2)13(16)14-5-7-19-8-6-15/h3-4,9,15H,5-8H2,1-2H3,(H,14,16) |
| InChIKey | OYPLVKSTJKBFCP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|