C12H18N2O4 — CID 55083724
5-amino-N-[2-(2-hydroxyethoxy)ethyl]-2-methoxybenzamide (PubChem CID 55083724) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 5-amino-N-[2-(2-hydroxyethoxy)ethyl]-2-methoxybenzamide.
| Compound Name | 5-amino-N-[2-(2-hydroxyethoxy)ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 55083724 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 5-amino-N-[2-(2-hydroxyethoxy)ethyl]-2-methoxybenzamide |
| SMILES | COc1ccc(N)cc1C(=O)NCCOCCO |
| InChI | InChI=1S/C12H18N2O4/c1-17-11-3-2-9(13)8-10(11)12(16)14-4-6-18-7-5-15/h2-3,8,15H,4-7,13H2,1H3,(H,14,16) |
| InChIKey | ZAKXMQYXJIYVPK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|