C26H36N2O6 — CID 3517424
N-[8-[(2,4-dimethoxybenzoyl)amino]octyl]-2,4-dimethoxybenzamide (PubChem CID 3517424) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is N-[8-[(2,4-dimethoxybenzoyl)amino]octyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[8-[(2,4-dimethoxybenzoyl)amino]octyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 3517424 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | N-[8-[(2,4-dimethoxybenzoyl)amino]octyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCCCCCCNC(=O)c2ccc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C26H36N2O6/c1-31-19-11-13-21(23(17-19)33-3)25(29)27-15-9-7-5-6-8-10-16-28-26(30)22-14-12-20(32-2)18-24(22)34-4/h11-14,17-18H,5-10,15-16H2,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | WDTQFYFRZTTWMU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|