C21H29N3O5S — CID 3585915
N-[2-(diethylamino)ethyl]-4-[(2,5-dimethoxyphenyl)sulfonylamino]benzamide (PubChem CID 3585915) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-[(2,5-dimethoxyphenyl)sulfonylamino]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-[(2,5-dimethoxyphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 3585915 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-[(2,5-dimethoxyphenyl)sulfonylamino]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NS(=O)(=O)c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C21H29N3O5S/c1-5-24(6-2)14-13-22-21(25)16-7-9-17(10-8-16)23-30(26,27)20-15-18(28-3)11-12-19(20)29-4/h7-12,15,23H,5-6,13-14H2,1-4H3,(H,22,25) |
| InChIKey | SYAXONPLJBKVPY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |