C25H32N4O3S — CID 54255975
N-[2-(diethylamino)ethyl]-4-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]benzamide (PubChem CID 54255975) has the molecular formula C25H32N4O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 54255975 |
| Molecular Formula | C25H32N4O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NS(=O)(=O)c2cccc3c(N(C)C)cccc23)cc1 |
| InChI | InChI=1S/C25H32N4O3S/c1-5-29(6-2)18-17-26-25(30)19-13-15-20(16-14-19)27-33(31,32)24-12-8-9-21-22(24)10-7-11-23(21)28(3)4/h7-16,27H,5-6,17-18H2,1-4H3,(H,26,30) |
| InChIKey | RACCJXONZVXOLA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |