C20H24F3N3O3S — CID 3691485
N-[2-(diethylamino)ethyl]-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide (PubChem CID 3691485) has the molecular formula C20H24F3N3O3S and a molecular weight of 443.49 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 3691485 |
| Molecular Formula | C20H24F3N3O3S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H24F3N3O3S/c1-3-26(4-2)13-12-24-19(27)15-8-10-17(11-9-15)25-30(28,29)18-7-5-6-16(14-18)20(21,22)23/h5-11,14,25H,3-4,12-13H2,1-2H3,(H,24,27) |
| InChIKey | IHVWVLXUHIDKHS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |