C23H19F3N2O5S — CID 174539218
4-[2-[[3-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzoyl]amino]ethyl]benzoic acid (PubChem CID 174539218) has the molecular formula C23H19F3N2O5S and a molecular weight of 492.48 g/mol. Its IUPAC name is 4-[2-[[3-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzoyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[[3-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzoyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 174539218 |
| Molecular Formula | C23H19F3N2O5S |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 4-[2-[[3-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzoyl]amino]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCNC(=O)c2cccc(NS(=O)(=O)c3cccc(C(F)(F)F)c3)c2)cc1 |
| InChI | InChI=1S/C23H19F3N2O5S/c24-23(25,26)18-4-2-6-20(14-18)34(32,33)28-19-5-1-3-17(13-19)21(29)27-12-11-15-7-9-16(10-8-15)22(30)31/h1-10,13-14,28H,11-12H2,(H,27,29)(H,30,31) |
| InChIKey | BIBCAHARDWEHON-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |