C14H10F3NO4S — CID 697781
4-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid (PubChem CID 697781) has the molecular formula C14H10F3NO4S and a molecular weight of 345.30 g/mol. Its IUPAC name is 4-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid.
| Compound Name | 4-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 697781 |
| Molecular Formula | C14H10F3NO4S |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 4-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C14H10F3NO4S/c15-14(16,17)10-2-1-3-12(8-10)23(21,22)18-11-6-4-9(5-7-11)13(19)20/h1-8,18H,(H,19,20) |
| InChIKey | NJEQBXPASRIDHG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |