C14H9F3NO4S- — CID 3458292
3-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzoate (PubChem CID 3458292) has the molecular formula C14H9F3NO4S- and a molecular weight of 344.29 g/mol. Its IUPAC name is 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzoate.
| Compound Name | 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 3458292 |
| Molecular Formula | C14H9F3NO4S- |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]benzoate |
| SMILES | O=C([O-])c1cccc(NS(=O)(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C14H10F3NO4S/c15-14(16,17)10-4-2-6-12(8-10)23(21,22)18-11-5-1-3-9(7-11)13(19)20/h1-8,18H,(H,19,20)/p-1 |
| InChIKey | LTXNSYUJJVHELV-UHFFFAOYSA-M |
| XLogP | 1.87 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |