C14H12NO4S- — CID 7040416
3-[(3-methylphenyl)sulfamoyl]benzoate (PubChem CID 7040416) has the molecular formula C14H12NO4S- and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-[(3-methylphenyl)sulfamoyl]benzoate.
| Compound Name | 3-[(3-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 7040416 |
| Molecular Formula | C14H12NO4S- |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 3-[(3-methylphenyl)sulfamoyl]benzoate |
| SMILES | Cc1cccc(NS(=O)(=O)c2cccc(C(=O)[O-])c2)c1 |
| InChI | InChI=1S/C14H13NO4S/c1-10-4-2-6-12(8-10)15-20(18,19)13-7-3-5-11(9-13)14(16)17/h2-9,15H,1H3,(H,16,17)/p-1 |
| InChIKey | SBCGIAAHIVKYKK-UHFFFAOYSA-M |
| XLogP | 1.16 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |