C16H12F6N2O3S — CID 37064206
N-(2,2,2-trifluoroethyl)-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide (PubChem CID 37064206) has the molecular formula C16H12F6N2O3S and a molecular weight of 426.34 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide.
| Compound Name | N-(2,2,2-trifluoroethyl)-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 37064206 |
| Molecular Formula | C16H12F6N2O3S |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
| SMILES | O=C(NCC(F)(F)F)c1cccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H12F6N2O3S/c17-15(18,19)9-23-14(25)10-3-1-6-13(7-10)28(26,27)24-12-5-2-4-11(8-12)16(20,21)22/h1-8,24H,9H2,(H,23,25) |
| InChIKey | UEYHJOOKHXPSPZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |