C22H19F3N2O3S — CID 31147171
4-(benzenesulfonamido)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 31147171) has the molecular formula C22H19F3N2O3S and a molecular weight of 448.47 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 31147171 |
| Molecular Formula | C22H19F3N2O3S |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | O=C(NCCc1ccc(C(F)(F)F)cc1)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19F3N2O3S/c23-22(24,25)18-10-6-16(7-11-18)14-15-26-21(28)17-8-12-19(13-9-17)27-31(29,30)20-4-2-1-3-5-20/h1-13,27H,14-15H2,(H,26,28) |
| InChIKey | ZGAIKXCORMVXJL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |