C22H20N4O4S — CID 24981727
4-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonylamino]-N-(2-phenylethyl)benzamide (PubChem CID 24981727) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is 4-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonylamino]-N-(2-phenylethyl)benzamide.
| Compound Name | 4-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonylamino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 24981727 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 4-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonylamino]-N-(2-phenylethyl)benzamide |
| SMILES | O=C(NCCc1ccccc1)c1ccc(NS(=O)(=O)c2ccc3[nH]c(=O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C22H20N4O4S/c27-21(23-13-12-15-4-2-1-3-5-15)16-6-8-17(9-7-16)26-31(29,30)18-10-11-19-20(14-18)25-22(28)24-19/h1-11,14,26H,12-13H2,(H,23,27)(H2,24,25,28) |
| InChIKey | TXWXYPQMPAWFFE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |