C16H16N4O4S — CID 110630632
N-[2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonylamino]ethyl]benzamide (PubChem CID 110630632) has the molecular formula C16H16N4O4S and a molecular weight of 360.40 g/mol. Its IUPAC name is N-[2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonylamino]ethyl]benzamide.
| Compound Name | N-[2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 110630632 |
| Molecular Formula | C16H16N4O4S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonylamino]ethyl]benzamide |
| SMILES | O=C(NCCNS(=O)(=O)c1ccc2[nH]c(=O)[nH]c2c1)c1ccccc1 |
| InChI | InChI=1S/C16H16N4O4S/c21-15(11-4-2-1-3-5-11)17-8-9-18-25(23,24)12-6-7-13-14(10-12)20-16(22)19-13/h1-7,10,18H,8-9H2,(H,17,21)(H2,19,20,22) |
| InChIKey | ZLCJXOGEUCNINY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|