C13H18N4O4S — CID 110417592
N-[4-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonylamino]butyl]acetamide (PubChem CID 110417592) has the molecular formula C13H18N4O4S and a molecular weight of 326.38 g/mol. Its IUPAC name is N-[4-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonylamino]butyl]acetamide.
| Compound Name | N-[4-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonylamino]butyl]acetamide |
|---|---|
| PubChem CID | 110417592 |
| Molecular Formula | C13H18N4O4S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[4-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonylamino]butyl]acetamide |
| SMILES | CC(=O)NCCCCNS(=O)(=O)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C13H18N4O4S/c1-9(18)14-6-2-3-7-15-22(20,21)10-4-5-11-12(8-10)17-13(19)16-11/h4-5,8,15H,2-3,6-7H2,1H3,(H,14,18)(H2,16,17,19) |
| InChIKey | BEZSUJRQMFCKGV-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|