C12H17N3O4S — CID 110418054
N-(4-methoxybutyl)-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide (PubChem CID 110418054) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is N-(4-methoxybutyl)-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide.
| Compound Name | N-(4-methoxybutyl)-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 110418054 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-(4-methoxybutyl)-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide |
| SMILES | COCCCCNS(=O)(=O)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C12H17N3O4S/c1-19-7-3-2-6-13-20(17,18)9-4-5-10-11(8-9)15-12(16)14-10/h4-5,8,13H,2-3,6-7H2,1H3,(H2,14,15,16) |
| InChIKey | OTZJTTOXBIOLFX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|