C15H15FN2O5S2 — CID 166407089
3-(2-benzamidoethylsulfamoyl)benzenesulfonyl fluoride (PubChem CID 166407089) has the molecular formula C15H15FN2O5S2 and a molecular weight of 386.43 g/mol. Its IUPAC name is 3-(2-benzamidoethylsulfamoyl)benzenesulfonyl fluoride.
| Compound Name | 3-(2-benzamidoethylsulfamoyl)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 166407089 |
| Molecular Formula | C15H15FN2O5S2 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 3-(2-benzamidoethylsulfamoyl)benzenesulfonyl fluoride |
| SMILES | O=C(NCCNS(=O)(=O)c1cccc(S(=O)(=O)F)c1)c1ccccc1 |
| InChI | InChI=1S/C15H15FN2O5S2/c16-24(20,21)13-7-4-8-14(11-13)25(22,23)18-10-9-17-15(19)12-5-2-1-3-6-12/h1-8,11,18H,9-10H2,(H,17,19) |
| InChIKey | NUYLFNNQGATADU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|