C15H13ClF2N2O3S — CID 32999320
N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3,4-difluorobenzamide (PubChem CID 32999320) has the molecular formula C15H13ClF2N2O3S and a molecular weight of 374.80 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3,4-difluorobenzamide.
| Compound Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 32999320 |
| Molecular Formula | C15H13ClF2N2O3S |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3,4-difluorobenzamide |
| SMILES | O=C(NCCNS(=O)(=O)c1cccc(Cl)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H13ClF2N2O3S/c16-11-2-1-3-12(9-11)24(22,23)20-7-6-19-15(21)10-4-5-13(17)14(18)8-10/h1-5,8-9,20H,6-7H2,(H,19,21) |
| InChIKey | YFYIIHCEQHYHEF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|