C13H21Cl2N3O3S — CID 119704291
N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119704291) has the molecular formula C13H21Cl2N3O3S and a molecular weight of 370.30 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119704291 |
| Molecular Formula | C13H21Cl2N3O3S |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NCCNS(=O)(=O)c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C13H20ClN3O3S.ClH/c1-15-7-3-6-13(18)16-8-9-17-21(19,20)12-5-2-4-11(14)10-12;/h2,4-5,10,15,17H,3,6-9H2,1H3,(H,16,18);1H |
| InChIKey | YZSCCXXWCOCSGH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|